ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
64-65-3 Bemegride |
|
Produkt-Name | Bemegride |
Englischer Name | Bemegride;3-Ethyl-3-methylglutarimide;4-Ethyl-4-methyl-2,6-piperidinedione;3-Methyl-3-ethylglutarimide;4-ethyl-4-methylpiperidine-2,6-dione |
Molekulare Formel | C8H13NO2 |
Molecular Weight | 155.1943 |
InChl | InChI=1/C8H13NO2/c1-3-8(2)4-6(10)9-7(11)5-8/h3-5H2,1-2H3,(H,9,10,11) |
CAS Registry Number | 64-65-3 |
EINECS | 200-588-0 |
Molecular Structure | ![]() |
Dichte | 1.024g/cm3 |
Schmelzpunkt | 126-129℃ |
Siedepunkt | 282°C at 760 mmHg |
Brechungsindex | 1.448 |
Flammpunkt | 125.8°C |
Dampfdruck | 0.00344mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |