ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
637-53-6 Thioacetanilide |
|
Produkt-Name | Thioacetanilide |
Englischer Name | Thioacetanilide;98%;THIOACETANILIDE 99%;N-phenylethanethioamide |
Molekulare Formel | C8H9NS |
Molecular Weight | 151.2288 |
InChl | InChI=1/C8H9NS/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10) |
CAS Registry Number | 637-53-6 |
EINECS | 211-288-4 |
Molecular Structure | |
Dichte | 1.16g/cm3 |
Schmelzpunkt | 76-79℃ |
Siedepunkt | 225.121°C at 760 mmHg |
Brechungsindex | 1.654 |
Flammpunkt | 89.95°C |
Dampfdruck | 0.088mmHg at 25°C |
Gefahrensymbole | Xn##Harmful:; |
Risk Codes | R20/21##Harmful by inhalation and in contact with skin.:; |
Safety Beschreibung | S23##Do not inhale gas/fumes/vapour/spray.:; |
MSDS |