ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
637-39-8 Triethanolamine hydrochloride |
|
Produkt-Name | Triethanolamine hydrochloride |
Englischer Name | Triethanolamine hydrochloride;2,2,2-Nitrilotriethanol hydrochloride~Tris(2-hydroxyethyl)amine hydrochloride;triethanolamine hcl;tris(2-hydroxyethyl)ammonium chloride;2,2',2''-nitrilotriethanol hydrochloride (1:1) |
Molekulare Formel | C6H16ClNO3 |
Molecular Weight | 185.6491 |
InChl | InChI=1/C6H15NO3.ClH/c8-4-1-7(2-5-9)3-6-10;/h8-10H,1-6H2;1H |
CAS Registry Number | 637-39-8 |
EINECS | 211-284-2 |
Molecular Structure | |
Schmelzpunkt | 177-179℃ |
Siedepunkt | 335.4°C at 760 mmHg |
Flammpunkt | 185°C |
Dampfdruck | 8.38E-06mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |