ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
636-70-4 Triethylamine hydrobromide |
|
Produkt-Name | Triethylamine hydrobromide |
Englischer Name | Triethylamine hydrobromide;triethylammonium bromide |
Molekulare Formel | C6H15N.HBr |
Molecular Weight | 182.10 |
InChl | InChI=1/C6H15N.BrH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H |
CAS Registry Number | 636-70-4 |
EINECS | 211-263-8 |
Molecular Structure | |
Schmelzpunkt | 246-248℃ |
Gefahrensymbole | Xi##Irritant:; |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |