ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
618-71-3 Ethyl 3,5-dinitrobenzoate |
|
Produkt-Name | Ethyl 3,5-dinitrobenzoate |
Englischer Name | Ethyl 3,5-dinitrobenzoate;3,5-Dinitrobenzoic acid ethyl ester |
Molekulare Formel | C9H8N2O6 |
Molecular Weight | 240.1696 |
InChl | InChI=1/C9H8N2O6/c1-2-17-9(12)6-3-7(10(13)14)5-8(4-6)11(15)16/h3-5H,2H2,1H3 |
CAS Registry Number | 618-71-3 |
EINECS | 210-559-4 |
Molecular Structure | ![]() |
Dichte | 1.433g/cm3 |
Schmelzpunkt | 94-95℃ |
Siedepunkt | 367.1°C at 760 mmHg |
Brechungsindex | 1.58 |
Flammpunkt | 171.8°C |
Dampfdruck | 1.39E-05mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |