ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Ethyl oxamate |
|
Produkt-Name | Ethyl oxamate |
Englischer Name | Ethyl oxamate;oxamethane;Oxamic acid ethyl ester;ethyl amino(oxo)acetate |
Molekulare Formel | C4H7NO3 |
Molecular Weight | 117.1033 |
InChl | InChI=1/C4H7NO3/c1-2-8-4(7)3(5)6/h2H2,1H3,(H2,5,6) |
CAS Registry Number | 617-36-7 |
EINECS | 210-512-8 |
Molecular Structure | |
Dichte | 1.184g/cm3 |
Schmelzpunkt | 112-115℃ |
Siedepunkt | 188.7°C at 760 mmHg |
Brechungsindex | 1.437 |
Flammpunkt | 87°C |
Dampfdruck | 0.59mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |