ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
615-94-1 2,5-Dihydroxy-1,4-benzoquinone |
|
Produkt-Name | 2,5-Dihydroxy-1,4-benzoquinone |
Englischer Name | 2,5-Dihydroxy-1,4-benzoquinone;2,5-Dihydroxybenzoquinone;2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
Molekulare Formel | C6H4O4 |
Molecular Weight | 140.0936 |
InChl | InChI=1/C6H4O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7,10H |
CAS Registry Number | 615-94-1 |
EINECS | 210-454-3 |
Molecular Structure | |
Dichte | 1.843g/cm3 |
Schmelzpunkt | 220℃ |
Siedepunkt | 322.3°C at 760 mmHg |
Brechungsindex | 1.729 |
Flammpunkt | 162.9°C |
Dampfdruck | 2.24E-05mmHg at 25°C |
Gefahrensymbole | Xn##Harmful:; |
Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Safety Beschreibung | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |