ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
615-35-0 N,N'-Dimethyloxamide |
|
Produkt-Name | N,N'-Dimethyloxamide |
Englischer Name | N,N'-Dimethyloxamide;NN-Dimethyloxamide;N,N-Dimethyloxamide;N,N'-Dimethyloxalamide;N,N'-dimethylethanediamide |
Molekulare Formel | C4H8N2O2 |
Molecular Weight | 116.1185 |
InChl | InChI=1/C4H8N2O2/c1-5-3(7)4(8)6-2/h1-2H3,(H,5,7)(H,6,8) |
CAS Registry Number | 615-35-0 |
EINECS | 210-420-8 |
Molecular Structure | ![]() |
Dichte | 1.091g/cm3 |
Schmelzpunkt | 214-217℃ |
Brechungsindex | 1.436 |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |