ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Bromo-4-methylacetanilide |
|
Produkt-Name | 2-Bromo-4-methylacetanilide |
Englischer Name | 2-Bromo-4-methylacetanilide;2-Bromo-4-methylactanilide;N-(2-bromo-4-methylphenyl)acetamide |
Molekulare Formel | C9H10BrNO |
Molecular Weight | 228.0858 |
InChl | InChI=1/C9H10BrNO/c1-6-3-4-9(8(10)5-6)11-7(2)12/h3-5H,1-2H3,(H,11,12) |
CAS Registry Number | 614-83-5 |
Molecular Structure | |
Dichte | 1.471g/cm3 |
Schmelzpunkt | 117-119℃ |
Siedepunkt | 349.9°C at 760 mmHg |
Brechungsindex | 1.6 |
Flammpunkt | 165.4°C |
Dampfdruck | 4.57E-05mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |