ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
P-Tolylbenzoat |
|
Produkt-Name | P-Tolylbenzoat |
Synonyme | ;p-Tolylbzoat (Benzoesäure-p-tolylester); Benzoesäure-p-Tolylester; 4-Methylphenylbenzoat; |
Englischer Name | P-tolyl benzoate;p-Tolyl benzoate (Benzoic acid p-tolyl ester);Benzoic acid p-tolyl ester;4-methylphenyl benzoate |
Molekulare Formel | C14H12O2 |
Molecular Weight | 212.2439 |
InChl | InChI=1/C14H12O2/c1-11-7-9-13(10-8-11)16-14(15)12-5-3-2-4-6-12/h2-10H,1H3 |
CAS Registry Number | 614-34-6 |
EINECS | 210-380-1 |
Molecular Structure | |
Dichte | 1.122g/cm3 |
Schmelzpunkt | 70-72℃ |
Siedepunkt | 316.6°C at 760 mmHg |
Brechungsindex | 1.577 |
Flammpunkt | 130.1°C |
Dampfdruck | 0.000407mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |