ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
613-21-8 2-methylquinolin-6-ol |
|
Produkt-Name | 2-methylquinolin-6-ol |
Englischer Name | 2-methylquinolin-6-ol;6-Hydroxy-2-methylquinoline;2-Methyl-6-hydroxyquinoline;2-Methyl-6-hydroxyquinoine |
Molekulare Formel | C10H9NO |
Molecular Weight | 159.1846 |
InChl | InChI=1/C10H9NO/c1-7-2-3-8-6-9(12)4-5-10(8)11-7/h2-6,12H,1H3 |
CAS Registry Number | 613-21-8 |
Molecular Structure | ![]() |
Dichte | 1.21g/cm3 |
Schmelzpunkt | 198℃ |
Siedepunkt | 304.5°C at 760 mmHg |
Brechungsindex | 1.666 |
Flammpunkt | 142.3°C |
Dampfdruck | 0.000483mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |