ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
613-03-6 1,2,4-Triacetoxybenzene |
|
Produkt-Name | 1,2,4-Triacetoxybenzene |
Englischer Name | 1,2,4-Triacetoxybenzene;1,2,4-Phenenyl triacetate;benzene-1,2,4-triyl triacetate;2-[(1-hydroxyethenyl)oxy]benzene-1,4-diyl diacetate |
Molekulare Formel | C12H12O6 |
Molecular Weight | 252.2201 |
InChl | InChI=1/C12H12O6/c1-7(13)16-10-4-5-11(17-8(2)14)12(6-10)18-9(3)15/h4-6,15H,3H2,1-2H3 |
CAS Registry Number | 613-03-6 |
EINECS | 210-327-2 |
Molecular Structure | ![]() |
Dichte | 1.276g/cm3 |
Schmelzpunkt | 98-100℃ |
Siedepunkt | 401°C at 760 mmHg |
Brechungsindex | 1.533 |
Flammpunkt | 153.2°C |
Dampfdruck | 3.77E-07mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |