Chemindex > 612-28-2
DE ▼
N-Methyl-2-nitroaniline |
|
| Produkt-Name | N-Methyl-2-nitroaniline |
| Englischer Name | N-Methyl-2-nitroaniline;Benzenamine, N-methyl-2-nitro-;2-Nitro-N-methylaniline;4-12-00-01564 (Beilstein Handbook Reference);Aniline, N-methyl-o-nitro-;BRN 2209110;N-Methyl-2-nitrobenzenamine;N-Methyl-o-nitroaniline;NSC 86672;o-(Methylamino)nitrobenzene;o-Nitro-N-methylaniline |
| Molekulare Formel | C7H8N2O2 |
| Molecular Weight | 152.1506 |
| InChl | InChI=1/C7H8N2O2/c1-8-6-4-2-3-5-7(6)9(10)11/h2-5,8H,1H3 |
| CAS Registry Number | 612-28-2 |
| EINECS | 210-303-1 |
| Molecular Structure |  |
| Dichte | 1.26g/cm3 |
| Schmelzpunkt | 33-37℃ |
| Siedepunkt | 277.9°C at 760 mmHg |
| Brechungsindex | 1.619 |
| Flammpunkt | 121.9°C |
| Dampfdruck | 0.0044mmHg at 25°C |
| Gefahrensymbole |  T##Toxic:; |
| Risk Codes | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.:; |
| Safety Beschreibung | S28A##After contact with skin, wash immediately with plenty of water.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 