ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Nitrobenzyl chloride |
|
Produkt-Name | 2-Nitrobenzyl chloride |
Englischer Name | 2-Nitrobenzyl chloride;alpha-Chloro-2-nitrotoluene;a-Chloro-2-nitrotoluene);1-chloro-2-methyl-3-nitrobenzene;1-(chloromethyl)-2-nitrobenzene |
Molekulare Formel | C7H6ClNO2 |
Molecular Weight | 171.581 |
InChl | InChI=1/C7H6ClNO2/c8-5-6-3-1-2-4-7(6)9(10)11/h1-4H,5H2 |
CAS Registry Number | 612-23-7 |
EINECS | 210-300-5 |
Molecular Structure | |
Dichte | 1.33g/cm3 |
Schmelzpunkt | 46-50℃ |
Siedepunkt | 269°C at 760 mmHg |
Brechungsindex | 1.574 |
Flammpunkt | 112.7°C |
Dampfdruck | 0.0123mmHg at 25°C |
Gefahrensymbole | C##Corrosive:; |
Risk Codes | R34##Causes burns.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |