ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
611-55-2 2-Amino-6,7-dimethyl-4-hydroxypteridine hydrate |
|
Produkt-Name | 2-Amino-6,7-dimethyl-4-hydroxypteridine hydrate |
Englischer Name | 2-Amino-6,7-dimethyl-4-hydroxypteridine hydrate;2-Amino-6,7-dimethylpteridin-4-ol;4-pteridinol, 2-amino-6,7-dimethyl-;2-amino-6,7-dimethylpteridin-4(1H)-one |
Molekulare Formel | C8H9N5O |
Molecular Weight | 191.19 |
InChl | InChI=1/C8H9N5O/c1-3-4(2)11-6-5(10-3)7(14)13-8(9)12-6/h1-2H3,(H3,9,11,12,13,14) |
CAS Registry Number | 611-55-2 |
EINECS | 210-270-3 |
Molecular Structure | |
Dichte | 1.65g/cm3 |
Schmelzpunkt | 330℃ |
Siedepunkt | 423.9°C at 760 mmHg |
Brechungsindex | 1.79 |
Flammpunkt | 210.1°C |
Dampfdruck | 2.16E-07mmHg at 25°C |
Gefahrensymbole | Xi##Irritant:; |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |