611-05-2 3-Methyl-4-nitroaniline |
| Produkt-Name |
3-Methyl-4-nitroaniline |
| Englischer Name |
3-Methyl-4-nitroaniline;3-Amino-6-nitrotoluene~4-Nitro-m-toluidine;4-Nitro-m-toluidine (NH2=1) |
| Molekulare Formel |
C7H8N2O2 |
| Molecular Weight |
152.1506 |
| InChl |
InChI=1/C7H8N2O2/c1-5-4-6(8)2-3-7(5)9(10)11/h2-4H,8H2,1H3 |
| CAS Registry Number |
611-05-2 |
| EINECS |
210-247-8 |
| Molecular Structure |
 |
| Dichte |
1.269g/cm3 |
| Siedepunkt |
330°C at 760 mmHg |
| Brechungsindex |
1.615 |
| Flammpunkt |
153.4°C |
| Dampfdruck |
0.000171mmHg at 25°C |
| Risk Codes |
R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.||R51/53##Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:;
|
| Safety Beschreibung |
S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:;
|
| MSDS |
Material Safety Data Sheet |
DE ▼
