ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
610-69-5 2-Nitrophenylacetat |
|
Produkt-Name | 2-Nitrophenylacetat |
Synonyme | 2-Nitrophenylacetat; Essigsäure-2-nitrophenylester; |
Englischer Name | 2-nitrophenyl acetate;2-Nitrophenyl acetate;Acetic acid 2-nitrophenyl ester |
Molekulare Formel | C8H7NO4 |
Molecular Weight | 181.1455 |
InChl | InChI=1/C8H7NO4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3 |
CAS Registry Number | 610-69-5 |
EINECS | 210-233-1 |
Molecular Structure | |
Dichte | 1.304g/cm3 |
Schmelzpunkt | 39-41℃ |
Siedepunkt | 274.8°C at 760 mmHg |
Brechungsindex | 1.548 |
Flammpunkt | 139.8°C |
Dampfdruck | 0.00528mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |