ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
610-34-4 Ethyl 2-nitrobenzoate |
|
Produkt-Name | Ethyl 2-nitrobenzoate |
Englischer Name | Ethyl 2-nitrobenzoate;2-Nitrobenzoic acid ethyl ester |
Molekulare Formel | C9H9NO4 |
Molecular Weight | 195.1721 |
InChl | InChI=1/C9H9NO4/c1-2-14-9(11)7-5-3-4-6-8(7)10(12)13/h3-6H,2H2,1H3 |
CAS Registry Number | 610-34-4 |
EINECS | 210-220-0 |
Molecular Structure | |
Dichte | 1.253g/cm3 |
Schmelzpunkt | 26-174℃ |
Siedepunkt | 275°C at 760 mmHg |
Brechungsindex | 1.544 |
Flammpunkt | 126.1°C |
Dampfdruck | 0.00523mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |