ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
608-28-6 2-Iodo-m-xylene |
|
Produkt-Name | 2-Iodo-m-xylene |
Englischer Name | 2-Iodo-m-xylene;2-Iodo-1,3-Dimethylbenzene |
Molekulare Formel | C8H9I |
Molecular Weight | 232.0615 |
InChl | InChI=1/C8H9I/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 |
CAS Registry Number | 608-28-6 |
EINECS | 210-158-4 |
Molecular Structure | |
Dichte | 1.61g/cm3 |
Siedepunkt | 227.5°C at 760 mmHg |
Brechungsindex | 1.592 |
Flammpunkt | 98.1°C |
Wasserlöslichkeit | insoluble |
Dampfdruck | 0.116mmHg at 25°C |
Gefahrensymbole | Xi##Irritant:; |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection:; |
MSDS |