ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
608-08-2 Indoxyl acetate |
|
Produkt-Name | Indoxyl acetate |
Englischer Name | Indoxyl acetate;3-Acetoxyindole~Indolyl acetate~Y-acetate;Indoxyl acetate 3-Indoxyl acetate;3-Indolyl acetate;3-Acetoxyindole;1H-indol-3-yl acetate |
Molekulare Formel | C10H9NO2 |
Molecular Weight | 175.184 |
InChl | InChI=1/C10H9NO2/c1-7(12)13-10-6-11-9-5-3-2-4-8(9)10/h2-6,11H,1H3 |
CAS Registry Number | 608-08-2 |
EINECS | 210-154-2 |
Molecular Structure | ![]() |
Dichte | 1.255g/cm3 |
Schmelzpunkt | 128-131℃ |
Siedepunkt | 339.1°C at 760 mmHg |
Brechungsindex | 1.633 |
Flammpunkt | 158.9°C |
Dampfdruck | 9.41E-05mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |