ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Isatin-3-oxime |
|
Produkt-Name | Isatin-3-oxime |
Englischer Name | Isatin-3-oxime;3-hydroxyiminoindolin-2-one;beta-Isatoxime;3-(hydroxyamino)-2H-indol-2-one |
Molekulare Formel | C8H6N2O2 |
Molecular Weight | 162.1454 |
InChl | InChI=1/C8H6N2O2/c11-8-7(10-12)5-3-1-2-4-6(5)9-8/h1-4,12H,(H,9,10,11) |
CAS Registry Number | 607-28-3 |
EINECS | 210-132-2 |
Molecular Structure | |
Dichte | 1.49g/cm3 |
Schmelzpunkt | 210-214℃ |
Siedepunkt | 400.5°C at 760 mmHg |
Brechungsindex | 1.706 |
Flammpunkt | 196°C |
Dampfdruck | 4.43E-08mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |