ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
N-Methylcarbostyril |
|
Produkt-Name | N-Methylcarbostyril |
Englischer Name | N-Methylcarbostyril;2-Hydroxy-1-methylquinoline;N-Methylcarbostyril;1-methylquinolin-2(1H)-one;1-methyl-2-Quinolinone |
Molekulare Formel | C10H9NO |
Molecular Weight | 159.1846 |
InChl | InChI=1/C10H9NO/c1-11-9-5-3-2-4-8(9)6-7-10(11)12/h2-7H,1H3 |
CAS Registry Number | 606-43-9 |
Molecular Structure | |
Dichte | 1.16g/cm3 |
Siedepunkt | 247.5°C at 760 mmHg |
Brechungsindex | 1.592 |
Flammpunkt | 106.8°C |
Dampfdruck | 0.0255mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |