ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
606-27-9 Methyl 2-nitrobenzoate |
|
Produkt-Name | Methyl 2-nitrobenzoate |
Englischer Name | Methyl 2-nitrobenzoate;2-Nitrobenzoic acid methyl ester |
Molekulare Formel | C8H7NO4 |
Molecular Weight | 181.1455 |
InChl | InChI=1/C8H7NO4/c1-13-8(10)6-4-2-3-5-7(6)9(11)12/h2-5H,1H3 |
CAS Registry Number | 606-27-9 |
EINECS | 210-111-8 |
Molecular Structure | ![]() |
Dichte | 1.301g/cm3 |
Schmelzpunkt | -13℃ |
Siedepunkt | 275°C at 760 mmHg |
Brechungsindex | 1.553 |
Flammpunkt | 124.8°C |
Dampfdruck | 0.00523mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |