ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Nitrobenzhydrazide |
|
Produkt-Name | 2-Nitrobenzhydrazide |
Englischer Name | 2-Nitrobenzhydrazide;2-Nitrobenzoic hydrazide;2-Nitrobenzoyl hydrazide;2-nitrobenzohydrazide |
Molekulare Formel | C7H7N3O3 |
Molecular Weight | 181.1488 |
InChl | InChI=1/C7H7N3O3/c8-9-7(11)5-3-1-2-4-6(5)10(12)13/h1-4H,8H2,(H,9,11) |
CAS Registry Number | 606-26-8 |
EINECS | 210-110-2 |
Molecular Structure | |
Dichte | 1.406g/cm3 |
Schmelzpunkt | 123℃ |
Brechungsindex | 1.621 |
Gefahrensymbole | Xi##Irritant:; |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |