ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
603-52-1 ethyl diphenylcarbamate |
|
Produkt-Name | ethyl diphenylcarbamate |
Englischer Name | ethyl diphenylcarbamate; |
Molekulare Formel | C15H15NO2 |
Molecular Weight | 241.2851 |
InChl | InChI=1/C15H15NO2/c1-2-18-15(17)16(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
CAS Registry Number | 603-52-1 |
EINECS | 210-047-0 |
Molecular Structure | ![]() |
Dichte | 1.146g/cm3 |
Schmelzpunkt | 70-72℃ |
Siedepunkt | 360°C at 760 mmHg |
Brechungsindex | 1.593 |
Flammpunkt | 171.5°C |
Dampfdruck | 2.29E-05mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |