ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
603-10-1 2,3,6-trinitrophenol moistened with water (H2O ~40%) |
|
Produkt-Name | 2,3,6-trinitrophenol moistened with water (H2O ~40%) |
Englischer Name | 2,3,6-trinitrophenol moistened with water (H2O ~40%); |
Molekulare Formel | C6H3N3O7 |
Molecular Weight | 229.1039 |
InChl | InChI=1/C6H3N3O7/c10-6-4(8(13)14)2-1-3(7(11)12)5(6)9(15)16/h1-2,10H |
CAS Registry Number | 603-10-1 |
Molecular Structure | ![]() |
Dichte | 1.856g/cm3 |
Schmelzpunkt | 119-120℃ |
Siedepunkt | 337.9°C at 760 mmHg |
Brechungsindex | 1.701 |
Flammpunkt | 151.1°C |
Dampfdruck | 5.2E-05mmHg at 25°C |
MSDS |