ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
602-87-9 5-Nitroacenaphthene |
|
Produkt-Name | 5-Nitroacenaphthene |
Englischer Name | 5-Nitroacenaphthene;1,2-Dihydro-5-nitro-acenaphthylene;4-05-00-01840 (Beilstein Handbook Reference);5-Nan;5-Nitroacenaphthylene;5-Nitroacenapthene;5-Nitronaphthalene;5-Nitronaphthalene ethylene;Acenaphthene, 5-nitro-;Acenaphthylene, 1,2-dihydro-5-nitro-;BRN 1876864;CCRIS 438;HSDB 4092;NCI-C01967;NSC 1312;NSC 22421;1,2-Dihydro-5-nitroacenaphthylene;5-nitro-1,2-dihydroacenaphthylene;Nitroacenaphthene;1,2-dihydro-5-nitro-acenaphthylen |
Molekulare Formel | C12H7NO2 |
Molecular Weight | 197.1895 |
InChl | InChI=1/C12H7NO2/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-7H |
CAS Registry Number | 602-87-9 |
EINECS | 210-025-0 |
Molecular Structure | |
Dichte | 1.408g/cm3 |
Schmelzpunkt | 101-102℃ |
Siedepunkt | 381.6°C at 760 mmHg |
Brechungsindex | 1.763 |
Flammpunkt | 196.7°C |
Dampfdruck | 1.1E-05mmHg at 25°C |
Risk Codes | R45##May cause cancer.:; |
Safety Beschreibung | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.:; |
MSDS |