Chemindex > 59-85-8
DE ▼
4-(chloromercurio)benzoic acid |
|
| Produkt-Name | 4-(chloromercurio)benzoic acid |
| Englischer Name | 4-(chloromercurio)benzoic acid;4-chloromercuriobenzoic acid;4-Chloromercuribenzoic acid;(4-carboxyphenyl)(chloro)mercury;(4-carboxyphenyl)mercury(1+) chloride |
| Molekulare Formel | C7H5ClHgO2 |
| Molecular Weight | 357.1564 |
| InChl | InChI=1/C7H5O2.ClH.Hg/c8-7(9)6-4-2-1-3-5-6;;/h2-5H,(H,8,9);1H;/q;;+1/p-1/rC7H5HgO2.ClH/c8-6-3-1-5(2-4-6)7(9)10;/h1-4H,(H,9,10);1H/q+1;/p-1 |
| CAS Registry Number | 59-85-8 |
| EINECS | 200-442-6 |
| Molecular Structure |  |
| Schmelzpunkt | 300℃ |
| Risk Codes | R26/27/28##Very toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.:; |
| Safety Beschreibung | S13##Keep away from food, drink and animal feeding stuffs.||S28##After contact with skin, wash immediately with plenty of ...||S36##Wear suitable protective clothing.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 