ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59-82-5 5-Nitro-2-furonitrile |
|
Produkt-Name | 5-Nitro-2-furonitrile |
Englischer Name | 5-Nitro-2-furonitrile;5-Nitro-2-furancarbonitrile;5-nitrofuran-2-carbonitrile |
Molekulare Formel | C5H2N2O3 |
Molecular Weight | 138.081 |
InChl | InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
CAS Registry Number | 59-82-5 |
Molecular Structure | |
Dichte | 1.46g/cm3 |
Siedepunkt | 234.7°C at 760 mmHg |
Brechungsindex | 1.544 |
Flammpunkt | 95.7°C |
Dampfdruck | 0.0522mmHg at 25°C |
Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Safety Beschreibung | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |