ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5720-05-8 4-Methylbenzeneboronic acid |
|
Produkt-Name | 4-Methylbenzeneboronic acid |
Englischer Name | 4-Methylbenzeneboronic acid;AKOS BRN-0019;4-Tolylboronic Acid;4-Tolyboronic Acid;4-Methylphenylboric Acid;4-Methylphenylboronic Acid;P-Methylphenylboronic Acid;P-Tolylboronic Acid;(4-Methylphenyl)Boronic Acid;(1R)-N-Methyl-1-Phenylethanamine |
Molekulare Formel | C9H13N |
Molecular Weight | 135.2062 |
InChl | InChI=1/C9H13N/c1-8(10-2)9-6-4-3-5-7-9/h3-8,10H,1-2H3/t8-/m1/s1 |
CAS Registry Number | 5720-05-8;917814-66-5 |
Molecular Structure | ![]() |
Dichte | 0.911g/cm3 |
Schmelzpunkt | 256-263℃ |
Siedepunkt | 178.7°C at 760 mmHg |
Brechungsindex | 1.505 |
Flammpunkt | 61.6°C |
Dampfdruck | 0.976mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |