ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-Nitroquinoline-N-oxide |
|
Produkt-Name | 4-Nitroquinoline-N-oxide |
Englischer Name | 4-Nitroquinoline-N-oxide;Nitroquinolineoxide;4-Nitroquinoline N-oxide;4-nitroquinoline 1-oxide;4-nitro-1-oxo-1,8a-dihydroquinolinium |
Molekulare Formel | C9H7N2O3 |
Molecular Weight | 191.1629 |
InChl | InChI=1/C9H7N2O3/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6,8H/q+1 |
CAS Registry Number | 56-57-5 |
EINECS | 200-281-1 |
Molecular Structure | |
Schmelzpunkt | 154-156℃ |
Gefahrensymbole | Xn##Harmful:; |
Risk Codes | R33##Danger of cummulative effects.:; |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |