ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56-53-1 Diethylstilbestrol |
|
Produkt-Name | Diethylstilbestrol |
Englischer Name | Diethylstilbestrol;Stilboestrol;a,a-Diethyl-4,4-Stilbenediol Carc.;Atovaquone;4,4'-(3E)-hex-3-ene-3,4-diyldiphenol;4,4'-(3Z)-hex-3-ene-3,4-diyldiphenol;diethylstilbestrol, mixture of cis and trans;Diethylstilbestrol,mixture of cis and trans;Diethylstilbestrol BP |
Molekulare Formel | C18H20O2 |
Molecular Weight | 268.3502 |
InChl | InChI=1/C18H20O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,19-20H,3-4H2,1-2H3/b18-17- |
CAS Registry Number | 56-53-1;6898-97-1 |
EINECS | 200-278-5 |
Molecular Structure | |
Dichte | 1.107g/cm3 |
Schmelzpunkt | 169-175℃ |
Siedepunkt | 407.1°C at 760 mmHg |
Brechungsindex | 1.603 |
Flammpunkt | 187°C |
Wasserlöslichkeit | PRACTICALLY INSOLUBLE |
Dampfdruck | 3.29E-07mmHg at 25°C |
Gefahrensymbole | T##Toxic||N##Dangerous for the environment:; |
Risk Codes | R40||R45||R61||R36/37/38||R51/53:; |
Safety Beschreibung | S36/37/39||S45||S53||S60||S61:; |
MSDS |