ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
55836-69-6 3-ethoxybenzamide |
|
Produkt-Name | 3-ethoxybenzamide |
Englischer Name | 3-ethoxybenzamide;m-Ethoxybenzamide;Benzamide, 3-ethoxy- |
Molekulare Formel | C9H11NO2 |
Molecular Weight | 165.1891 |
InChl | InChI=1/C9H11NO2/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6H,2H2,1H3,(H2,10,11) |
CAS Registry Number | 55836-69-6 |
EINECS | 259-846-6 |
Molecular Structure | |
Dichte | 1.111g/cm3 |
Schmelzpunkt | 138-140℃ |
Siedepunkt | 293.4°C at 760 mmHg |
Brechungsindex | 1.538 |
Flammpunkt | 145.8°C |
Dampfdruck | 0.00173mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |