Chemindex > 54792-21-1
DE ▼
54792-21-1 4-(2,4-dichlorophenoxy)butyric acid, compound with 2,2'-iminodiethanol (1:1) |
|
| Produkt-Name | 4-(2,4-dichlorophenoxy)butyric acid, compound with 2,2'-iminodiethanol (1:1) |
| Englischer Name | 4-(2,4-dichlorophenoxy)butyric acid, compound with 2,2'-iminodiethanol (1:1);4-(2,4-Dichlorophenoxy)butyric acid, compound with 2,2'-iminodiethanol (1:1);4-(2,4-dichlorophenoxy)butanoic acid - 2,2'-iminodiethanol (1:1) |
| Molekulare Formel | C14H21Cl2NO5 |
| Molecular Weight | 354.2262 |
| InChl | InChI=1/C10H10Cl2O3.C4H11NO2/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14;6-3-1-5-2-4-7/h3-4,6H,1-2,5H2,(H,13,14);5-7H,1-4H2 |
| CAS Registry Number | 54792-21-1 |
| EINECS | 259-353-6 |
| Molecular Structure |  |
| Siedepunkt | 410.4°C at 760 mmHg |
| Flammpunkt | 202°C |
| Dampfdruck | 1.8E-07mmHg at 25°C |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Lieferanten für 54792-21-1 (0):
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 