ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54376-65-7 4-Diethylaminobenzaldehyde oxime |
|
Produkt-Name | 4-Diethylaminobenzaldehyde oxime |
Englischer Name | 4-Diethylaminobenzaldehyde oxime;4-Diethylaminobenzaldoxime |
Molekulare Formel | C11H16N2O |
Molecular Weight | 192.2575 |
InChl | InChI=1/C11H16N2O/c1-3-13(4-2)11-7-5-10(6-8-11)9-12-14/h5-9,14H,3-4H2,1-2H3/b12-9+ |
CAS Registry Number | 54376-65-7 |
Molecular Structure | |
Dichte | 1g/cm3 |
Siedepunkt | 307.7°C at 760 mmHg |
Brechungsindex | 1.517 |
Flammpunkt | 139.9°C |
Dampfdruck | 0.000309mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |