ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
538-62-5 Phenylazoformic acid 2-phenylhydrazide |
|
Produkt-Name | Phenylazoformic acid 2-phenylhydrazide |
Englischer Name | Phenylazoformic acid 2-phenylhydrazide;SYM-DIPHENYLCARBAZONE;(E)-N',2-diphenyldiazenecarbohydrazide;Diphenylcarbazone;Diphenyl carbazone |
Molekulare Formel | C13H12N4O |
Molecular Weight | 240.2606 |
InChl | InChI=1/C13H12N4O/c18-13(16-14-11-7-3-1-4-8-11)17-15-12-9-5-2-6-10-12/h1-10,14H,(H,16,18)/b17-15- |
CAS Registry Number | 538-62-5 |
EINECS | 208-698-0 |
Molecular Structure | |
Schmelzpunkt | 153-157℃ |
Brechungsindex | 1.617 |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |