ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52605-96-6 2-Chloro-3-methoxypyridine |
|
Produkt-Name | 2-Chloro-3-methoxypyridine |
Englischer Name | 2-Chloro-3-methoxypyridine; |
Molekulare Formel | C6H6ClNO |
Molecular Weight | 143.5709 |
InChl | InChI=1/C6H6ClNO/c1-9-5-3-2-4-8-6(5)7/h2-4H,1H3 |
CAS Registry Number | 52605-96-6 |
EINECS | 258-039-6 |
Molecular Structure | |
Dichte | 1.21g/cm3 |
Siedepunkt | 210.6°C at 760 mmHg |
Brechungsindex | 1.517 |
Flammpunkt | 81.2°C |
Dampfdruck | 0.276mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |