ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
butane-2,3-diol |
|
Produkt-Name | butane-2,3-diol |
Englischer Name | butane-2,3-diol;2,3-Butanediol;2,3-Dihydroxybutane;2,3-Butanediol, mixture of DL and meso;2,3-butylene glycol;(2R,3S)-butane-2,3-diol |
Molekulare Formel | C4H10O2 |
Molecular Weight | 90.121 |
InChl | InChI=1/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H3 |
CAS Registry Number | 513-85-9;123513-85-9 |
EINECS | 208-173-6 |
Molecular Structure | |
Dichte | 0.997g/cm3 |
Schmelzpunkt | 25℃ |
Siedepunkt | 180.7°C at 760 mmHg |
Brechungsindex | 1.434 |
Flammpunkt | 85°C |
Wasserlöslichkeit | SOLUBLE |
Dampfdruck | 0.26mmHg at 25°C |
Safety Beschreibung | S24/25:; |
MSDS |