ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50877-92-4 Bernsteinsäure, Verbindung mit Harnstoff (1:1) |
|
Produkt-Name | Bernsteinsäure, Verbindung mit Harnstoff (1:1) |
Synonyme | Bernsteinsäure, Verbindung mit Harnstoff (1:1); Harnstoff-Butandiiat; |
Englischer Name | succinic acid, compound with urea (1:1);Succinic acid, compound with urea (1:1);urea butanedioate |
Molekulare Formel | C5H10N2O5 |
Molecular Weight | 178.1433 |
InChl | InChI=1/C4H6O4.CH4N2O/c5-3(6)1-2-4(7)8;2-1(3)4/h1-2H2,(H,5,6)(H,7,8);(H4,2,3,4) |
CAS Registry Number | 50877-92-4 |
EINECS | 256-823-2 |
Molecular Structure | ![]() |
Siedepunkt | 236.1°C at 760 mmHg |
Flammpunkt | 110.9°C |
Dampfdruck | 0.0165mmHg at 25°C |
MSDS |