ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
506-50-3 Triacontanoic acid |
|
Produkt-Name | Triacontanoic acid |
Englischer Name | Triacontanoic acid; |
Molekulare Formel | C30H60O2 |
Molecular Weight | 452.7962 |
InChl | InChI=1/C30H60O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30(31)32/h2-29H2,1H3,(H,31,32) |
CAS Registry Number | 506-50-3 |
EINECS | 208-042-3 |
Molecular Structure | ![]() |
Dichte | 0.873g/cm3 |
Schmelzpunkt | 91-94℃ |
Siedepunkt | 441.4°C at 760 mmHg |
Brechungsindex | 1.462 |
Flammpunkt | 196.9°C |
Dampfdruck | 1.44E-08mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |