ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
506-24-1 stearolic acid |
|
Produkt-Name | stearolic acid |
Englischer Name | stearolic acid;Octadec-9-ynoic acid |
Molekulare Formel | C18H32O2 |
Molecular Weight | 280.4455 |
InChl | InChI=1/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-8,11-17H2,1H3,(H,19,20) |
CAS Registry Number | 506-24-1 |
EINECS | 208-030-8 |
Molecular Structure | |
Dichte | 0.923g/cm3 |
Siedepunkt | 405.2°C at 760 mmHg |
Brechungsindex | 1.471 |
Flammpunkt | 196.3°C |
Dampfdruck | 1.07E-07mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |