Chemindex > 50529-33-4
DE ▼
50529-33-4 3-chloro-4-(fluorophenyl)isocyanate |
|
| Produkt-Name | 3-chloro-4-(fluorophenyl)isocyanate |
| Englischer Name | 3-chloro-4-(fluorophenyl)isocyanate;3-Chloro-4-fluorophenyl isocyanate;2-chloro-1-fluoro-4-isocyanatobenzene |
| Molekulare Formel | C7H3ClFNO |
| Molecular Weight | 171.5562 |
| InChl | InChI=1/C7H3ClFNO/c8-6-3-5(10-4-11)1-2-7(6)9/h1-3H |
| CAS Registry Number | 50529-33-4 |
| Molecular Structure |  |
| Dichte | 1.31g/cm3 |
| Siedepunkt | 228.7°C at 760 mmHg |
| Brechungsindex | 1.533 |
| Flammpunkt | 92.1°C |
| Dampfdruck | 0.0723mmHg at 25°C |
| Gefahrensymbole |  Xn##Harmful:; |
| Risk Codes | R23/25##Toxic by inhalation and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.||R42##May cause sensitization by inhalation.:; |
| Safety Beschreibung | S23##Do not inhale gas/fumes/vapour/spray.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 