ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
10-Nonadecanone |
|
Produkt-Name | 10-Nonadecanone |
Englischer Name | 10-Nonadecanone;Di-n-nonyl ketone;nonadecan-10-one |
Molekulare Formel | C19H38O |
Molecular Weight | 282.5044 |
InChl | InChI=1/C19H38O/c1-3-5-7-9-11-13-15-17-19(20)18-16-14-12-10-8-6-4-2/h3-18H2,1-2H3 |
CAS Registry Number | 504-57-4 |
EINECS | 207-994-7 |
Molecular Structure | |
Dichte | 0.832g/cm3 |
Schmelzpunkt | 55-57℃ |
Siedepunkt | 351.2°C at 760 mmHg |
Brechungsindex | 1.443 |
Flammpunkt | 81.6°C |
Dampfdruck | 4.17E-05mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |