ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
504-20-1 phorone |
|
Produkt-Name | phorone |
Englischer Name | phorone;2,6-Dimethyl-2,5-heptadien-4-one;Diisopropyllideneacetone;2,6-dimethylhepta-2,5-dien-4-one |
Molekulare Formel | C9H14O |
Molecular Weight | 138.2069 |
InChl | InChI=1/C9H14O/c1-7(2)5-9(10)6-8(3)4/h5-6H,1-4H3 |
CAS Registry Number | 504-20-1 |
EINECS | 207-986-3 |
Molecular Structure | |
Dichte | 0.858g/cm3 |
Schmelzpunkt | 23-26℃ |
Siedepunkt | 198.5°C at 760 mmHg |
Brechungsindex | 1.453 |
Flammpunkt | 79.4°C |
Dampfdruck | 0.358mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |