ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
504-08-5 2,4-Diamino-s-triazin |
|
Produkt-Name | 2,4-Diamino-s-triazin |
Synonyme | ;D Iaminotriazin; 1,3,5-Triazin-2,4-diamin; 2,4-Diamino-1,3,5-Triazin; |
Englischer Name | 2,4-Diamino-s-triazine;Diaminotriazine;1,3,5-triazine-2,4-diamine;2,4-Diamino-1,3,5-Triazine |
Molekulare Formel | C3H5N5 |
Molecular Weight | 111.1053 |
InChl | InChI=1/C3H5N5/c4-2-6-1-7-3(5)8-2/h1H,(H4,4,5,6,7,8) |
CAS Registry Number | 504-08-5 |
EINECS | 207-983-7 |
Molecular Structure | ![]() |
Dichte | 1.508g/cm3 |
Siedepunkt | 447.6°C at 760 mmHg |
Brechungsindex | 1.716 |
Flammpunkt | 254.9°C |
Dampfdruck | 3.32E-08mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |