ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
6-(Methylthio)purine |
|
Produkt-Name | 6-(Methylthio)purine |
Englischer Name | 6-(Methylthio)purine;6-(Methylmercapto)purine;6-(Methylsulfanyl)-9H-purine;6-(methylsulfanyl)-7H-purine;6-(methylsulfanyl)-5H-purine |
Molekulare Formel | C6H6N4S |
Molecular Weight | 166.2036 |
InChl | InChI=1/C6H6N4S/c1-11-6-4-5(8-2-7-4)9-3-10-6/h2-4H,1H3 |
CAS Registry Number | 50-66-8 |
EINECS | 200-057-3 |
Molecular Structure | |
Dichte | 1.59g/cm3 |
Schmelzpunkt | 221-222℃ |
Siedepunkt | 290.9°C at 760 mmHg |
Brechungsindex | 1.806 |
Flammpunkt | 129.7°C |
Dampfdruck | 0.00351mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |