ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,4-ethylfluorobenzene |
|
Produkt-Name | 1,4-ethylfluorobenzene |
Englischer Name | 1,4-ethylfluorobenzene;1-Ethyl-4-fluorobenzene;benzene, 1-ethyl-4-fluoro-;Ethyl-4-fluorobenzene |
Molekulare Formel | C8H9F |
Molecular Weight | 124.1555 |
InChl | InChI=1/C8H9F/c1-2-7-3-5-8(9)6-4-7/h3-6H,2H2,1H3 |
CAS Registry Number | 459-47-2 |
Molecular Structure | |
Dichte | 0.981g/cm3 |
Siedepunkt | 141.6°C at 760 mmHg |
Brechungsindex | 1.477 |
Flammpunkt | 28.9°C |
Dampfdruck | 7.26mmHg at 25°C |
Risk Codes | R10##Flammable.:; |
Safety Beschreibung | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |