ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
455-37-8 3-fluorobenzamide |
|
Produkt-Name | 3-fluorobenzamide |
Englischer Name | 3-fluorobenzamide;m-Fluorobenzamide |
Molekulare Formel | C7H6FNO |
Molecular Weight | 139.127 |
InChl | InChI=1/C7H6FNO/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H2,9,10) |
CAS Registry Number | 455-37-8 |
EINECS | 207-247-5 |
Molecular Structure | |
Dichte | 1.238g/cm3 |
Schmelzpunkt | 129-132℃ |
Siedepunkt | 238.4°C at 760 mmHg |
Brechungsindex | 1.538 |
Flammpunkt | 98°C |
Dampfdruck | 0.0426mmHg at 25°C |
Gefahrensymbole | Xi##Irritant:; |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |