ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Fluoro-5-Iodotoluene |
|
Produkt-Name | 2-Fluoro-5-Iodotoluene |
Englischer Name | 2-Fluoro-5-Iodotoluene; |
Molekulare Formel | C7H6FI |
Molecular Weight | 236.02 |
InChl | InChI=1/C7H6FI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
CAS Registry Number | 452-68-6 |
EINECS | 207-206-1 |
Molecular Structure | |
Risk Codes | R36/38##Irritating to eyes and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |