ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,2-Dihydronaphthalene |
|
Produkt-Name | 1,2-Dihydronaphthalene |
Englischer Name | 1,2-Dihydronaphthalene;1,2-DIHYDRONAPHTHALENE;naphthalene, 1,2-dihydro- |
Molekulare Formel | C10H10 |
Molecular Weight | 130.1864 |
InChl | InChI=1/C10H10/c1-2-6-10-8-4-3-7-9(10)5-1/h1-3,5-7H,4,8H2 |
CAS Registry Number | 447-53-0 |
EINECS | 207-183-8 |
Molecular Structure | |
Dichte | 1.004g/cm3 |
Schmelzpunkt | -8℃ |
Siedepunkt | 204.9°C at 760 mmHg |
Brechungsindex | 1.572 |
Flammpunkt | 70.4°C |
Dampfdruck | 0.367mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |